About tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol
tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol (PubChem CID 22106791) has the molecular formula C15H31NO3
and a molecular weight of 273.42 g/mol. Its IUPAC name is tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol.
Molecular Properties
| Compound Name | tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol |
| PubChem CID | 22106791 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol |
| SMILES | CC(C)(C)OC(N)=O.CC1CCC(CCCO)CC1 |
| InChI | InChI=1S/C10H20O.C5H11NO2/c1-9-4-6-10(7-5-9)3-2-8-11;1-5(2,3)8-4(6)7/h9-11H,2-8H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | FDUZMCOCHWJJAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol?
The IUPAC name of tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol (CID 22106791) is tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol.
What is the SMILES notation for tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol?
The canonical SMILES for tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol is CC(C)(C)OC(N)=O.CC1CCC(CCCO)CC1.
What is the InChIKey of tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol?
The InChIKey is FDUZMCOCHWJJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C5H11NO2/c1-9-4-6-10(7-5-9)3-2-8-11;1-5(2,3)8-4(6)7/h9-11H,2-8H2,1H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol?
tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol has a molecular weight of 273.42 g/mol, XLogP of 3.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;3-(4-methylcyclohexyl)propan-1-ol is sourced from PubChem (CID 22106791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).