C16H19NO4 — CID 174445455
2-amino-3-(3,8-dimethoxynaphthalen-2-yl)butanoic acid (PubChem CID 174445455) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-amino-3-(3,8-dimethoxynaphthalen-2-yl)butanoic acid.
| Compound Name | 2-amino-3-(3,8-dimethoxynaphthalen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 174445455 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-amino-3-(3,8-dimethoxynaphthalen-2-yl)butanoic acid |
| SMILES | COc1cc2cccc(OC)c2cc1C(C)C(N)C(=O)O |
| InChI | InChI=1S/C16H19NO4/c1-9(15(17)16(18)19)11-8-12-10(7-14(11)21-3)5-4-6-13(12)20-2/h4-9,15H,17H2,1-3H3,(H,18,19) |
| InChIKey | DIJFMJBUPFSBGO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |