C11H19N5 — CID 174446134
1-N'-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]ethane-1,1-diamine (PubChem CID 174446134) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-N'-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 174446134 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-N'-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]ethane-1,1-diamine |
| SMILES | CC(N)Nc1ccc(N2CCC(N)C2)nc1 |
| InChI | InChI=1S/C11H19N5/c1-8(12)15-10-2-3-11(14-6-10)16-5-4-9(13)7-16/h2-3,6,8-9,15H,4-5,7,12-13H2,1H3 |
| InChIKey | XTAURONXGUPPMG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|