C24H34N2O — CID 174447370
2-amino-4-[4-[ethyl(3-phenylpropyl)amino]cyclohexyl]-3-methylphenol (PubChem CID 174447370) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-amino-4-[4-[ethyl(3-phenylpropyl)amino]cyclohexyl]-3-methylphenol.
| Compound Name | 2-amino-4-[4-[ethyl(3-phenylpropyl)amino]cyclohexyl]-3-methylphenol |
|---|---|
| PubChem CID | 174447370 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 2-amino-4-[4-[ethyl(3-phenylpropyl)amino]cyclohexyl]-3-methylphenol |
| SMILES | CCN(CCCc1ccccc1)C1CCC(c2ccc(O)c(N)c2C)CC1 |
| InChI | InChI=1S/C24H34N2O/c1-3-26(17-7-10-19-8-5-4-6-9-19)21-13-11-20(12-14-21)22-15-16-23(27)24(25)18(22)2/h4-6,8-9,15-16,20-21,27H,3,7,10-14,17,25H2,1-2H3 |
| InChIKey | USYNVEJAYAPYQK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|