C23H23FO2 — CID 174447857
tert-butyl 7-fluoro-1,2,3,4-tetrahydrochrysene-2-carboxylate (PubChem CID 174447857) has the molecular formula C23H23FO2 and a molecular weight of 350.43 g/mol. Its IUPAC name is tert-butyl 7-fluoro-1,2,3,4-tetrahydrochrysene-2-carboxylate.
| Compound Name | tert-butyl 7-fluoro-1,2,3,4-tetrahydrochrysene-2-carboxylate |
|---|---|
| PubChem CID | 174447857 |
| Molecular Formula | C23H23FO2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | tert-butyl 7-fluoro-1,2,3,4-tetrahydrochrysene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCc2c(ccc3c2ccc2c(F)cccc23)C1 |
| InChI | InChI=1S/C23H23FO2/c1-23(2,3)26-22(25)15-8-9-16-14(13-15)7-10-19-17-5-4-6-21(24)20(17)12-11-18(16)19/h4-7,10-12,15H,8-9,13H2,1-3H3 |
| InChIKey | PQDUOPSWGSGCSJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|