About azane;1-fluoro-4-(1-methylcyclopentyl)benzene
azane;1-fluoro-4-(1-methylcyclopentyl)benzene (PubChem CID 174449315) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is azane;1-fluoro-4-(1-methylcyclopentyl)benzene.
Molecular Properties
| Compound Name | azane;1-fluoro-4-(1-methylcyclopentyl)benzene |
| PubChem CID | 174449315 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | azane;1-fluoro-4-(1-methylcyclopentyl)benzene |
| SMILES | CC1(c2ccc(F)cc2)CCCC1.N |
| InChI | InChI=1S/C12H15F.H3N/c1-12(8-2-3-9-12)10-4-6-11(13)7-5-10;/h4-7H,2-3,8-9H2,1H3;1H3 |
| InChIKey | JSDBLYMJDILVEX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-fluoro-4-(1-methylcyclopentyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-fluoro-4-(1-methylcyclopentyl)benzene?
The IUPAC name of azane;1-fluoro-4-(1-methylcyclopentyl)benzene (CID 174449315) is azane;1-fluoro-4-(1-methylcyclopentyl)benzene.
What is the SMILES notation for azane;1-fluoro-4-(1-methylcyclopentyl)benzene?
The canonical SMILES for azane;1-fluoro-4-(1-methylcyclopentyl)benzene is CC1(c2ccc(F)cc2)CCCC1.N.
What is the InChIKey of azane;1-fluoro-4-(1-methylcyclopentyl)benzene?
The InChIKey is JSDBLYMJDILVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F.H3N/c1-12(8-2-3-9-12)10-4-6-11(13)7-5-10;/h4-7H,2-3,8-9H2,1H3;1H3.
What are the key properties of azane;1-fluoro-4-(1-methylcyclopentyl)benzene?
azane;1-fluoro-4-(1-methylcyclopentyl)benzene has a molecular weight of 195.28 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-fluoro-4-(1-methylcyclopentyl)benzene is sourced from PubChem (CID 174449315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).