C25H23NO4S — CID 174450029
2-[3-[4-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl]phenoxy]prop-2-enoic acid (PubChem CID 174450029) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[3-[4-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl]phenoxy]prop-2-enoic acid.
| Compound Name | 2-[3-[4-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl]phenoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 174450029 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[3-[4-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl]phenoxy]prop-2-enoic acid |
| SMILES | C=C(Oc1cccc(-c2ccc(OC(C)N3CCSc4ccccc43)cc2)c1)C(=O)O |
| InChI | InChI=1S/C25H23NO4S/c1-17(25(27)28)29-22-7-5-6-20(16-22)19-10-12-21(13-11-19)30-18(2)26-14-15-31-24-9-4-3-8-23(24)26/h3-13,16,18H,1,14-15H2,2H3,(H,27,28) |
| InChIKey | CWXQEXQBBVGQII-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|