C25H25NO4S — CID 174435889
(E)-3-[6-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]naphthalen-1-yl]-2-ethoxyprop-2-enoic acid (PubChem CID 174435889) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is (E)-3-[6-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]naphthalen-1-yl]-2-ethoxyprop-2-enoic acid.
| Compound Name | (E)-3-[6-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]naphthalen-1-yl]-2-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 174435889 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (E)-3-[6-[1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]naphthalen-1-yl]-2-ethoxyprop-2-enoic acid |
| SMILES | CCO/C(=C/c1cccc2cc(OC(C)N3CCSc4ccccc43)ccc12)C(=O)O |
| InChI | InChI=1S/C25H25NO4S/c1-3-29-23(25(27)28)16-19-8-6-7-18-15-20(11-12-21(18)19)30-17(2)26-13-14-31-24-10-5-4-9-22(24)26/h4-12,15-17H,3,13-14H2,1-2H3,(H,27,28)/b23-16+ |
| InChIKey | SNKPTTBWDRMQQU-XQNSMLJCSA-N |
| XLogP | 5.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|