C17H31F3N2O — CID 174452409
1-[4-[propan-2-yl(4,4,4-trifluorobutan-2-yl)amino]butyl]piperidine-2-carbaldehyde (PubChem CID 174452409) has the molecular formula C17H31F3N2O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[4-[propan-2-yl(4,4,4-trifluorobutan-2-yl)amino]butyl]piperidine-2-carbaldehyde.
| Compound Name | 1-[4-[propan-2-yl(4,4,4-trifluorobutan-2-yl)amino]butyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174452409 |
| Molecular Formula | C17H31F3N2O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 1-[4-[propan-2-yl(4,4,4-trifluorobutan-2-yl)amino]butyl]piperidine-2-carbaldehyde |
| SMILES | CC(C)N(CCCCN1CCCCC1C=O)C(C)CC(F)(F)F |
| InChI | InChI=1S/C17H31F3N2O/c1-14(2)22(15(3)12-17(18,19)20)11-7-6-10-21-9-5-4-8-16(21)13-23/h13-16H,4-12H2,1-3H3 |
| InChIKey | LQQRWUUWRRYVTK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|