C8H12F3NO — CID 175417338
1-(1,2,2-trifluoroethyl)piperidine-2-carbaldehyde (PubChem CID 175417338) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)piperidine-2-carbaldehyde.
| Compound Name | 1-(1,2,2-trifluoroethyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 175417338 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1C(F)C(F)F |
| InChI | InChI=1S/C8H12F3NO/c9-7(10)8(11)12-4-2-1-3-6(12)5-13/h5-8H,1-4H2 |
| InChIKey | WQNJJGKIHDOHKJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|