About benzaldehyde;trifluoromethoxyethene
benzaldehyde;trifluoromethoxyethene (PubChem CID 174453379) has the molecular formula C10H9F3O2
and a molecular weight of 218.17 g/mol. Its IUPAC name is benzaldehyde;trifluoromethoxyethene.
Molecular Properties
| Compound Name | benzaldehyde;trifluoromethoxyethene |
| PubChem CID | 174453379 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | benzaldehyde;trifluoromethoxyethene |
| SMILES | C=COC(F)(F)F.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C3H3F3O/c8-6-7-4-2-1-3-5-7;1-2-7-3(4,5)6/h1-6H;2H,1H2 |
| InChIKey | QNHLBYODWMBLTB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;trifluoromethoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;trifluoromethoxyethene?
The IUPAC name of benzaldehyde;trifluoromethoxyethene (CID 174453379) is benzaldehyde;trifluoromethoxyethene.
What is the SMILES notation for benzaldehyde;trifluoromethoxyethene?
The canonical SMILES for benzaldehyde;trifluoromethoxyethene is C=COC(F)(F)F.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;trifluoromethoxyethene?
The InChIKey is QNHLBYODWMBLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C3H3F3O/c8-6-7-4-2-1-3-5-7;1-2-7-3(4,5)6/h1-6H;2H,1H2.
What are the key properties of benzaldehyde;trifluoromethoxyethene?
benzaldehyde;trifluoromethoxyethene has a molecular weight of 218.17 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;trifluoromethoxyethene is sourced from PubChem (CID 174453379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).