C8H11N3O3 — CID 174453913
3-amino-5-(2-methylpropanoyl)-1H-pyrimidine-2,4-dione (PubChem CID 174453913) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-amino-5-(2-methylpropanoyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-amino-5-(2-methylpropanoyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174453913 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-amino-5-(2-methylpropanoyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)C(=O)c1c[nH]c(=O)n(N)c1=O |
| InChI | InChI=1S/C8H11N3O3/c1-4(2)6(12)5-3-10-8(14)11(9)7(5)13/h3-4H,9H2,1-2H3,(H,10,14) |
| InChIKey | SLNICPSHRSXQLB-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |