About [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane
[6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane (PubChem CID 174454683) has the molecular formula C12H18OSi
and a molecular weight of 206.36 g/mol. Its IUPAC name is [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane.
Molecular Properties
| Compound Name | [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane |
| PubChem CID | 174454683 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane |
| SMILES | C[SiH2]C1CCCC(C=C2C=CC=C2)O1 |
| InChI | InChI=1S/C12H18OSi/c1-14-12-8-4-7-11(13-12)9-10-5-2-3-6-10/h2-3,5-6,9,11-12H,4,7-8,14H2,1H3 |
| InChIKey | YTKBLMGZHSTNAP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane?
The IUPAC name of [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane (CID 174454683) is [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane.
What is the SMILES notation for [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane?
The canonical SMILES for [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane is C[SiH2]C1CCCC(C=C2C=CC=C2)O1.
What is the InChIKey of [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane?
The InChIKey is YTKBLMGZHSTNAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OSi/c1-14-12-8-4-7-11(13-12)9-10-5-2-3-6-10/h2-3,5-6,9,11-12H,4,7-8,14H2,1H3.
What are the key properties of [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane?
[6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane has a molecular weight of 206.36 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane is sourced from PubChem (CID 174454683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).