C12H18OSi — CID 174454683
[6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane (PubChem CID 174454683) has the molecular formula C12H18OSi and a molecular weight of 206.36 g/mol. Its IUPAC name is [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane.
| Compound Name | [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane |
|---|---|
| PubChem CID | 174454683 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [6-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-methylsilane |
| SMILES | C[SiH2]C1CCCC(C=C2C=CC=C2)O1 |
| InChI | InChI=1S/C12H18OSi/c1-14-12-8-4-7-11(13-12)9-10-5-2-3-6-10/h2-3,5-6,9,11-12H,4,7-8,14H2,1H3 |
| InChIKey | YTKBLMGZHSTNAP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|