About 3-aminopropyl undecane-3-sulfonate
3-aminopropyl undecane-3-sulfonate (PubChem CID 174455247) has the molecular formula C14H31NO3S
and a molecular weight of 293.47 g/mol. Its IUPAC name is 3-aminopropyl undecane-3-sulfonate.
Molecular Properties
| Compound Name | 3-aminopropyl undecane-3-sulfonate |
| PubChem CID | 174455247 |
| Molecular Formula | C14H31NO3S |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-aminopropyl undecane-3-sulfonate |
| SMILES | CCCCCCCCC(CC)S(=O)(=O)OCCCN |
| InChI | InChI=1S/C14H31NO3S/c1-3-5-6-7-8-9-11-14(4-2)19(16,17)18-13-10-12-15/h14H,3-13,15H2,1-2H3 |
| InChIKey | HBFVJDHGZPPRQX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl undecane-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl undecane-3-sulfonate?
The IUPAC name of 3-aminopropyl undecane-3-sulfonate (CID 174455247) is 3-aminopropyl undecane-3-sulfonate.
What is the SMILES notation for 3-aminopropyl undecane-3-sulfonate?
The canonical SMILES for 3-aminopropyl undecane-3-sulfonate is CCCCCCCCC(CC)S(=O)(=O)OCCCN.
What is the InChIKey of 3-aminopropyl undecane-3-sulfonate?
The InChIKey is HBFVJDHGZPPRQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO3S/c1-3-5-6-7-8-9-11-14(4-2)19(16,17)18-13-10-12-15/h14H,3-13,15H2,1-2H3.
What are the key properties of 3-aminopropyl undecane-3-sulfonate?
3-aminopropyl undecane-3-sulfonate has a molecular weight of 293.47 g/mol, XLogP of 3.21, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl undecane-3-sulfonate is sourced from PubChem (CID 174455247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).