About ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride
ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride (PubChem CID 174455565) has the molecular formula C11H14ClNO5S
and a molecular weight of 307.76 g/mol. Its IUPAC name is ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride.
Molecular Properties
| Compound Name | ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride |
| PubChem CID | 174455565 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(/CS(=O)(=O)c1ccccc1)OC(=O)OCC |
| InChI | InChI=1S/C11H13NO5S.ClH/c1-2-16-11(13)17-10(12)8-18(14,15)9-6-4-3-5-7-9;/h3-7,12H,2,8H2,1H3;1H/b12-10-; |
| InChIKey | TYQYTVUJRYIMEI-BBJSDXRSSA-N |
| XLogP | 2.03 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride?
The IUPAC name of ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride (CID 174455565) is ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride.
What is the SMILES notation for ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride?
The canonical SMILES for ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride is Cl.[H]/N=C(/CS(=O)(=O)c1ccccc1)OC(=O)OCC.
What is the InChIKey of ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride?
The InChIKey is TYQYTVUJRYIMEI-BBJSDXRSSA-N. The full InChI is InChI=1S/C11H13NO5S.ClH/c1-2-16-11(13)17-10(12)8-18(14,15)9-6-4-3-5-7-9;/h3-7,12H,2,8H2,1H3;1H/b12-10-;.
What are the key properties of ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride?
ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride has a molecular weight of 307.76 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxycarbonyl 2-(benzenesulfonyl)ethanimidate;hydrochloride is sourced from PubChem (CID 174455565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).