About (3-fluorophenyl) propaneperoxoate
(3-fluorophenyl) propaneperoxoate (PubChem CID 174455690) has the molecular formula C9H9FO3
and a molecular weight of 184.17 g/mol. Its IUPAC name is (3-fluorophenyl) propaneperoxoate.
Molecular Properties
| Compound Name | (3-fluorophenyl) propaneperoxoate |
| PubChem CID | 174455690 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (3-fluorophenyl) propaneperoxoate |
| SMILES | CCC(=O)OOc1cccc(F)c1 |
| InChI | InChI=1S/C9H9FO3/c1-2-9(11)13-12-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3 |
| InChIKey | NGZCWSJROSJYQW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) propaneperoxoate?
The IUPAC name of (3-fluorophenyl) propaneperoxoate (CID 174455690) is (3-fluorophenyl) propaneperoxoate.
What is the SMILES notation for (3-fluorophenyl) propaneperoxoate?
The canonical SMILES for (3-fluorophenyl) propaneperoxoate is CCC(=O)OOc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl) propaneperoxoate?
The InChIKey is NGZCWSJROSJYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3/c1-2-9(11)13-12-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3.
What are the key properties of (3-fluorophenyl) propaneperoxoate?
(3-fluorophenyl) propaneperoxoate has a molecular weight of 184.17 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) propaneperoxoate is sourced from PubChem (CID 174455690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).