C9H14N4OS — CID 174458914
1-piperidin-4-yl-1-(1,3-thiazol-2-yl)urea (PubChem CID 174458914) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-piperidin-4-yl-1-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-piperidin-4-yl-1-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 174458914 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-piperidin-4-yl-1-(1,3-thiazol-2-yl)urea |
| SMILES | NC(=O)N(c1nccs1)C1CCNCC1 |
| InChI | InChI=1S/C9H14N4OS/c10-8(14)13(9-12-5-6-15-9)7-1-3-11-4-2-7/h5-7,11H,1-4H2,(H2,10,14) |
| InChIKey | BVGBGUXOIQFLNO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |