C17H17N3OS — CID 2425944
4-cyano-N-cyclohexyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 2425944) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-cyano-N-cyclohexyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-cyano-N-cyclohexyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2425944 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-cyano-N-cyclohexyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | N#Cc1ccc(C(=O)N(c2nccs2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H17N3OS/c18-12-13-6-8-14(9-7-13)16(21)20(17-19-10-11-22-17)15-4-2-1-3-5-15/h6-11,15H,1-5H2 |
| InChIKey | KALGEILSECSGHK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |