C17H16ClNO2 — CID 174459513
1-chloro-4-(4-methylphenyl)-3,4-dihydro-2H-quinoline-2-carboxylic acid (PubChem CID 174459513) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is 1-chloro-4-(4-methylphenyl)-3,4-dihydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-chloro-4-(4-methylphenyl)-3,4-dihydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 174459513 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-chloro-4-(4-methylphenyl)-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| SMILES | Cc1ccc(C2CC(C(=O)O)N(Cl)c3ccccc32)cc1 |
| InChI | InChI=1S/C17H16ClNO2/c1-11-6-8-12(9-7-11)14-10-16(17(20)21)19(18)15-5-3-2-4-13(14)15/h2-9,14,16H,10H2,1H3,(H,20,21) |
| InChIKey | PRMVZJHGIOWJLT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|