C15H12N4O2 — CID 174460775
2-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)benzamide (PubChem CID 174460775) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)benzamide.
| Compound Name | 2-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)benzamide |
|---|---|
| PubChem CID | 174460775 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)benzamide |
| SMILES | NC(=O)c1ccccc1-c1c(-c2ccncc2)noc1N |
| InChI | InChI=1S/C15H12N4O2/c16-14(20)11-4-2-1-3-10(11)12-13(19-21-15(12)17)9-5-7-18-8-6-9/h1-8H,17H2,(H2,16,20) |
| InChIKey | TVWCTGIAUOQKAO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |