C11H15N7O — CID 174468123
1-pyridin-4-yl-1-[4-(2H-tetrazol-5-yl)butyl]urea (PubChem CID 174468123) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-pyridin-4-yl-1-[4-(2H-tetrazol-5-yl)butyl]urea.
| Compound Name | 1-pyridin-4-yl-1-[4-(2H-tetrazol-5-yl)butyl]urea |
|---|---|
| PubChem CID | 174468123 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-pyridin-4-yl-1-[4-(2H-tetrazol-5-yl)butyl]urea |
| SMILES | NC(=O)N(CCCCc1nn[nH]n1)c1ccncc1 |
| InChI | InChI=1S/C11H15N7O/c12-11(19)18(9-4-6-13-7-5-9)8-2-1-3-10-14-16-17-15-10/h4-7H,1-3,8H2,(H2,12,19)(H,14,15,16,17) |
| InChIKey | WETXMFVCVZFGEB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|