2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride

C8H17FO5S — CID 174468355

IUPAC2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride
SMILESCCCOCC(CO)OCCS(=O)(=O)F
InChIInChI=1S/C8H17FO5S/c1-2-3-13-7-8(6-10)14-4-5-15(9,11)12/h8,10H,2-7H2,1H3
InChIKeyFPQCDUZUXNNMEZ-UHFFFAOYSA-N
MW244.28 g/mol
LogP0.09
Rot. Bonds9

About 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride

2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride (PubChem CID 174468355) has the molecular formula C8H17FO5S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride.

Molecular Properties

Compound Name2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride
PubChem CID174468355
Molecular FormulaC8H17FO5S
Molecular Weight244.28 g/mol
Exact Mass244.08
IUPAC Name2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride
SMILESCCCOCC(CO)OCCS(=O)(=O)F
InChIInChI=1S/C8H17FO5S/c1-2-3-13-7-8(6-10)14-4-5-15(9,11)12/h8,10H,2-7H2,1H3
InChIKeyFPQCDUZUXNNMEZ-UHFFFAOYSA-N
XLogP0.09
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.28
LogP ≤ 50.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride?
The IUPAC name of 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride (CID 174468355) is 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride.
What is the SMILES notation for 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride?
The canonical SMILES for 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride is CCCOCC(CO)OCCS(=O)(=O)F.
What is the InChIKey of 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride?
The InChIKey is FPQCDUZUXNNMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FO5S/c1-2-3-13-7-8(6-10)14-4-5-15(9,11)12/h8,10H,2-7H2,1H3.
What are the key properties of 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride?
2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride has a molecular weight of 244.28 g/mol, XLogP of 0.09, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-3-propoxypropan-2-yl)oxyethanesulfonyl fluoride is sourced from PubChem (CID 174468355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).