C10H21NaO6S — CID 20700098
sodium 1-(1-hydroxypropan-2-yloxy)-4-propan-2-yloxybutane-2-sulfonate (PubChem CID 20700098) has the molecular formula C10H21NaO6S and a molecular weight of 292.33 g/mol. Its IUPAC name is sodium 1-(1-hydroxypropan-2-yloxy)-4-propan-2-yloxybutane-2-sulfonate.
| Compound Name | sodium 1-(1-hydroxypropan-2-yloxy)-4-propan-2-yloxybutane-2-sulfonate |
|---|---|
| PubChem CID | 20700098 |
| Molecular Formula | C10H21NaO6S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | sodium 1-(1-hydroxypropan-2-yloxy)-4-propan-2-yloxybutane-2-sulfonate |
| SMILES | CC(C)OCCC(COC(C)CO)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H22O6S.Na/c1-8(2)15-5-4-10(17(12,13)14)7-16-9(3)6-11;/h8-11H,4-7H2,1-3H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | YIYABPIEOXSBLW-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|