About 3-tert-butyl-5-methoxyphenol;dioxotitanium
3-tert-butyl-5-methoxyphenol;dioxotitanium (PubChem CID 174468851) has the molecular formula C11H16O4Ti
and a molecular weight of 260.11 g/mol. Its IUPAC name is 3-tert-butyl-5-methoxyphenol;dioxotitanium.
Molecular Properties
| Compound Name | 3-tert-butyl-5-methoxyphenol;dioxotitanium |
| PubChem CID | 174468851 |
| Molecular Formula | C11H16O4Ti |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-tert-butyl-5-methoxyphenol;dioxotitanium |
| SMILES | COc1cc(O)cc(C(C)(C)C)c1.O=[Ti]=O |
| InChI | InChI=1S/C11H16O2.2O.Ti/c1-11(2,3)8-5-9(12)7-10(6-8)13-4;;;/h5-7,12H,1-4H3;;; |
| InChIKey | JAKUADRRMJTTLM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-5-methoxyphenol;dioxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-methoxyphenol;dioxotitanium?
The IUPAC name of 3-tert-butyl-5-methoxyphenol;dioxotitanium (CID 174468851) is 3-tert-butyl-5-methoxyphenol;dioxotitanium.
What is the SMILES notation for 3-tert-butyl-5-methoxyphenol;dioxotitanium?
The canonical SMILES for 3-tert-butyl-5-methoxyphenol;dioxotitanium is COc1cc(O)cc(C(C)(C)C)c1.O=[Ti]=O.
What is the InChIKey of 3-tert-butyl-5-methoxyphenol;dioxotitanium?
The InChIKey is JAKUADRRMJTTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.2O.Ti/c1-11(2,3)8-5-9(12)7-10(6-8)13-4;;;/h5-7,12H,1-4H3;;;.
What are the key properties of 3-tert-butyl-5-methoxyphenol;dioxotitanium?
3-tert-butyl-5-methoxyphenol;dioxotitanium has a molecular weight of 260.11 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-methoxyphenol;dioxotitanium is sourced from PubChem (CID 174468851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).