C21H29BrFNO5S — CID 174469848
3-[4-(2-bromo-4-fluorophenoxy)piperidin-1-yl]sulfonyl-2-cyclopentylpentanoic acid (PubChem CID 174469848) has the molecular formula C21H29BrFNO5S and a molecular weight of 506.43 g/mol. Its IUPAC name is 3-[4-(2-bromo-4-fluorophenoxy)piperidin-1-yl]sulfonyl-2-cyclopentylpentanoic acid.
| Compound Name | 3-[4-(2-bromo-4-fluorophenoxy)piperidin-1-yl]sulfonyl-2-cyclopentylpentanoic acid |
|---|---|
| PubChem CID | 174469848 |
| Molecular Formula | C21H29BrFNO5S |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 3-[4-(2-bromo-4-fluorophenoxy)piperidin-1-yl]sulfonyl-2-cyclopentylpentanoic acid |
| SMILES | CCC(C(C(=O)O)C1CCCC1)S(=O)(=O)N1CCC(Oc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C21H29BrFNO5S/c1-2-19(20(21(25)26)14-5-3-4-6-14)30(27,28)24-11-9-16(10-12-24)29-18-8-7-15(23)13-17(18)22/h7-8,13-14,16,19-20H,2-6,9-12H2,1H3,(H,25,26) |
| InChIKey | DBKIDKMKCLQURX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |