C26H20ClN3O4S2 — CID 174470924
[5-[[2-[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]acetyl]amino]-2-phenylphenyl]methanesulfonic acid (PubChem CID 174470924) has the molecular formula C26H20ClN3O4S2 and a molecular weight of 538.05 g/mol. Its IUPAC name is [5-[[2-[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]acetyl]amino]-2-phenylphenyl]methanesulfonic acid.
| Compound Name | [5-[[2-[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]acetyl]amino]-2-phenylphenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 174470924 |
| Molecular Formula | C26H20ClN3O4S2 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | [5-[[2-[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]acetyl]amino]-2-phenylphenyl]methanesulfonic acid |
| SMILES | O=C(Cc1ccc2nc(-c3ccc(Cl)s3)[nH]c2c1)Nc1ccc(-c2ccccc2)c(CS(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H20ClN3O4S2/c27-24-11-10-23(35-24)26-29-21-9-6-16(12-22(21)30-26)13-25(31)28-19-7-8-20(17-4-2-1-3-5-17)18(14-19)15-36(32,33)34/h1-12,14H,13,15H2,(H,28,31)(H,29,30)(H,32,33,34) |
| InChIKey | FLFSGPLNPBUGNZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|