C30H27NO4 — CID 174471570
2-[[4-[[2-(2-phenylpropanoylamino)phenoxy]methyl]phenyl]methyl]benzoic acid (PubChem CID 174471570) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[[4-[[2-(2-phenylpropanoylamino)phenoxy]methyl]phenyl]methyl]benzoic acid.
| Compound Name | 2-[[4-[[2-(2-phenylpropanoylamino)phenoxy]methyl]phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 174471570 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[[4-[[2-(2-phenylpropanoylamino)phenoxy]methyl]phenyl]methyl]benzoic acid |
| SMILES | CC(C(=O)Nc1ccccc1OCc1ccc(Cc2ccccc2C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO4/c1-21(24-9-3-2-4-10-24)29(32)31-27-13-7-8-14-28(27)35-20-23-17-15-22(16-18-23)19-25-11-5-6-12-26(25)30(33)34/h2-18,21H,19-20H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | QLXPOQLPRAKQNX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |