C29H25NO3 — CID 10296681
2-[[2-[2-(4-phenylphenyl)propanoylamino]phenyl]methyl]benzoic acid (PubChem CID 10296681) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[[2-[2-(4-phenylphenyl)propanoylamino]phenyl]methyl]benzoic acid.
| Compound Name | 2-[[2-[2-(4-phenylphenyl)propanoylamino]phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10296681 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[[2-[2-(4-phenylphenyl)propanoylamino]phenyl]methyl]benzoic acid |
| SMILES | CC(C(=O)Nc1ccccc1Cc1ccccc1C(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO3/c1-20(21-15-17-23(18-16-21)22-9-3-2-4-10-22)28(31)30-27-14-8-6-12-25(27)19-24-11-5-7-13-26(24)29(32)33/h2-18,20H,19H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | LXRLDTIBWVRJAS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |