C12H9NO2S — CID 17447192
[5-(1,3-benzothiazol-2-yl)furan-2-yl]methanol (PubChem CID 17447192) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is [5-(1,3-benzothiazol-2-yl)furan-2-yl]methanol.
| Compound Name | [5-(1,3-benzothiazol-2-yl)furan-2-yl]methanol |
|---|---|
| PubChem CID | 17447192 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | [5-(1,3-benzothiazol-2-yl)furan-2-yl]methanol |
| SMILES | OCc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C12H9NO2S/c14-7-8-5-6-10(15-8)12-13-9-3-1-2-4-11(9)16-12/h1-6,14H,7H2 |
| InChIKey | GCSOVDAMZIDBEI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |