C14H8N2O2S — CID 2789038
(Z)-2-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-3-hydroxyprop-2-enenitrile (PubChem CID 2789038) has the molecular formula C14H8N2O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-3-hydroxyprop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 2789038 |
| Molecular Formula | C14H8N2O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-3-hydroxyprop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccco1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H8N2O2S/c15-8-9(13(17)11-5-3-7-18-11)14-16-10-4-1-2-6-12(10)19-14/h1-7,17H/b13-9- |
| InChIKey | FZMOVWVPQOHLKQ-LCYFTJDESA-N |
| XLogP | 3.84 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|