C14H8N2OS2 — CID 1242818
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enenitrile (PubChem CID 1242818) has the molecular formula C14H8N2OS2 and a molecular weight of 284.37 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1242818 |
| Molecular Formula | C14H8N2OS2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccco1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H8N2OS2/c15-9-11(8-10-4-3-7-17-10)18-14-16-12-5-1-2-6-13(12)19-14/h1-8H/b11-8+ |
| InChIKey | UOZULYVTECBXNM-DHZHZOJOSA-N |
| XLogP | 4.55 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|