About 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol
2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol (PubChem CID 174472910) has the molecular formula C17H34O5
and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol.
Molecular Properties
| Compound Name | 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol |
| PubChem CID | 174472910 |
| Molecular Formula | C17H34O5 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol |
| SMILES | COCOC(C)C(CCC1(CCO)CCCCC1)OCOC |
| InChI | InChI=1S/C17H34O5/c1-15(21-13-19-2)16(22-14-20-3)7-10-17(11-12-18)8-5-4-6-9-17/h15-16,18H,4-14H2,1-3H3 |
| InChIKey | LMFRXJVKOVUOSC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol?
The IUPAC name of 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol (CID 174472910) is 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol.
What is the SMILES notation for 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol?
The canonical SMILES for 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol is COCOC(C)C(CCC1(CCO)CCCCC1)OCOC.
What is the InChIKey of 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol?
The InChIKey is LMFRXJVKOVUOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O5/c1-15(21-13-19-2)16(22-14-20-3)7-10-17(11-12-18)8-5-4-6-9-17/h15-16,18H,4-14H2,1-3H3.
What are the key properties of 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol?
2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol has a molecular weight of 318.45 g/mol, XLogP of 3.10, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[3,4-bis(methoxymethoxy)pentyl]cyclohexyl]ethanol is sourced from PubChem (CID 174472910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).