C10H16ClNO4 — CID 174475976
carboxy 2-ethenyl-5-imino-2,3-dimethylpentanoate;hydrochloride (PubChem CID 174475976) has the molecular formula C10H16ClNO4 and a molecular weight of 249.69 g/mol. Its IUPAC name is carboxy 2-ethenyl-5-imino-2,3-dimethylpentanoate;hydrochloride.
| Compound Name | carboxy 2-ethenyl-5-imino-2,3-dimethylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 174475976 |
| Molecular Formula | C10H16ClNO4 |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | carboxy 2-ethenyl-5-imino-2,3-dimethylpentanoate;hydrochloride |
| SMILES | Cl.[H]/N=C/CC(C)C(C)(C=C)C(=O)OC(=O)O |
| InChI | InChI=1S/C10H15NO4.ClH/c1-4-10(3,7(2)5-6-11)8(12)15-9(13)14;/h4,6-7,11H,1,5H2,2-3H3,(H,13,14);1H/b11-6+; |
| InChIKey | HNEVKRGZIPOFME-ICSBZGNSSA-N |
| XLogP | 2.50 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|