C14H22LiO3P — CID 174476951
lithium;butane;(2,6-dimethoxy-4-methylphenyl)-phosphanylmethanone (PubChem CID 174476951) has the molecular formula C14H22LiO3P and a molecular weight of 276.24 g/mol. Its IUPAC name is lithium;butane;(2,6-dimethoxy-4-methylphenyl)-phosphanylmethanone.
| Compound Name | lithium;butane;(2,6-dimethoxy-4-methylphenyl)-phosphanylmethanone |
|---|---|
| PubChem CID | 174476951 |
| Molecular Formula | C14H22LiO3P |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | lithium;butane;(2,6-dimethoxy-4-methylphenyl)-phosphanylmethanone |
| SMILES | COc1cc(C)cc(OC)c1C(=O)P.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C10H13O3P.C4H9.Li/c1-6-4-7(12-2)9(10(11)14)8(5-6)13-3;1-3-4-2;/h4-5H,14H2,1-3H3;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | JAUOMBZJYMXEPJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|