About thiophen-3-ylmethyl N-phenylcarbamate
thiophen-3-ylmethyl N-phenylcarbamate (PubChem CID 174477055) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is thiophen-3-ylmethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | thiophen-3-ylmethyl N-phenylcarbamate |
| PubChem CID | 174477055 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | thiophen-3-ylmethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCc1ccsc1 |
| InChI | InChI=1S/C12H11NO2S/c14-12(13-11-4-2-1-3-5-11)15-8-10-6-7-16-9-10/h1-7,9H,8H2,(H,13,14) |
| InChIKey | QJVCCDCCSREACC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophen-3-ylmethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-ylmethyl N-phenylcarbamate?
The IUPAC name of thiophen-3-ylmethyl N-phenylcarbamate (CID 174477055) is thiophen-3-ylmethyl N-phenylcarbamate.
What is the SMILES notation for thiophen-3-ylmethyl N-phenylcarbamate?
The canonical SMILES for thiophen-3-ylmethyl N-phenylcarbamate is O=C(Nc1ccccc1)OCc1ccsc1.
What is the InChIKey of thiophen-3-ylmethyl N-phenylcarbamate?
The InChIKey is QJVCCDCCSREACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c14-12(13-11-4-2-1-3-5-11)15-8-10-6-7-16-9-10/h1-7,9H,8H2,(H,13,14).
What are the key properties of thiophen-3-ylmethyl N-phenylcarbamate?
thiophen-3-ylmethyl N-phenylcarbamate has a molecular weight of 233.29 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-ylmethyl N-phenylcarbamate is sourced from PubChem (CID 174477055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).