About (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid
(4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid (PubChem CID 174478547) has the molecular formula C27H27N3O12
and a molecular weight of 585.52 g/mol. Its IUPAC name is (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid.
Molecular Properties
| Compound Name | (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid |
| PubChem CID | 174478547 |
| Molecular Formula | C27H27N3O12 |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid |
| SMILES | CC(=O)Oc1ccc([N+](=O)[O-])cc1.CC(C(=O)O)c1ccc([N+](=O)[O-])cc1.O=C(O)CCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11NO4.C9H9NO4.C8H7NO4/c12-10(13)3-1-2-8-4-6-9(7-5-8)11(14)15;1-6(9(11)12)7-2-4-8(5-3-7)10(13)14;1-6(10)13-8-4-2-7(3-5-8)9(11)12/h4-7H,1-3H2,(H,12,13);2-6H,1H3,(H,11,12);2-5H,1H3 |
| InChIKey | AKZOWBOIOYDDNG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 230.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid?
The IUPAC name of (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid (CID 174478547) is (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid.
What is the SMILES notation for (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid?
The canonical SMILES for (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid is CC(=O)Oc1ccc([N+](=O)[O-])cc1.CC(C(=O)O)c1ccc([N+](=O)[O-])cc1.O=C(O)CCCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid?
The InChIKey is AKZOWBOIOYDDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C9H9NO4.C8H7NO4/c12-10(13)3-1-2-8-4-6-9(7-5-8)11(14)15;1-6(9(11)12)7-2-4-8(5-3-7)10(13)14;1-6(10)13-8-4-2-7(3-5-8)9(11)12/h4-7H,1-3H2,(H,12,13);2-6H,1H3,(H,11,12);2-5H,1H3.
What are the key properties of (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid?
(4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid has a molecular weight of 585.52 g/mol, XLogP of 5.31, 10 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) acetate;4-(4-nitrophenyl)butanoic acid;2-(4-nitrophenyl)propanoic acid is sourced from PubChem (CID 174478547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).