C19H27N3O — CID 174479049
3-[3-[ethyl(pyrrolidin-1-yl)amino]-1-hydroxycyclohexyl]benzonitrile (PubChem CID 174479049) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-[3-[ethyl(pyrrolidin-1-yl)amino]-1-hydroxycyclohexyl]benzonitrile.
| Compound Name | 3-[3-[ethyl(pyrrolidin-1-yl)amino]-1-hydroxycyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 174479049 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 3-[3-[ethyl(pyrrolidin-1-yl)amino]-1-hydroxycyclohexyl]benzonitrile |
| SMILES | CCN(C1CCCC(O)(c2cccc(C#N)c2)C1)N1CCCC1 |
| InChI | InChI=1S/C19H27N3O/c1-2-22(21-11-3-4-12-21)18-9-6-10-19(23,14-18)17-8-5-7-16(13-17)15-20/h5,7-8,13,18,23H,2-4,6,9-12,14H2,1H3 |
| InChIKey | OMWCIHCSNDPLBW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |