About 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile
3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile (PubChem CID 153277604) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile |
| PubChem CID | 153277604 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile |
| SMILES | CN(C)C[C@H]1CNCC[C@]1(O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H21N3O/c1-18(2)11-14-10-17-7-6-15(14,19)13-5-3-4-12(8-13)9-16/h3-5,8,14,17,19H,6-7,10-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | VDZCTTFWSRLHCG-CABCVRRESA-N |
| XLogP | 0.92 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile?
The IUPAC name of 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile (CID 153277604) is 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile.
What is the SMILES notation for 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile?
The canonical SMILES for 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile is CN(C)C[C@H]1CNCC[C@]1(O)c1cccc(C#N)c1.
What is the InChIKey of 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile?
The InChIKey is VDZCTTFWSRLHCG-CABCVRRESA-N. The full InChI is InChI=1S/C15H21N3O/c1-18(2)11-14-10-17-7-6-15(14,19)13-5-3-4-12(8-13)9-16/h3-5,8,14,17,19H,6-7,10-11H2,1-2H3/t14-,15+/m1/s1.
What are the key properties of 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile?
3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile has a molecular weight of 259.35 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4R)-3-[(dimethylamino)methyl]-4-hydroxypiperidin-4-yl]benzonitrile is sourced from PubChem (CID 153277604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).