C14H21NO3 — CID 15050165
(3R,4S)-3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)oxan-4-ol (PubChem CID 15050165) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (3R,4S)-3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)oxan-4-ol.
| Compound Name | (3R,4S)-3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)oxan-4-ol |
|---|---|
| PubChem CID | 15050165 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (3R,4S)-3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)oxan-4-ol |
| SMILES | CN(C)C[C@@H]1COCC[C@@]1(O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H21NO3/c1-15(2)9-12-10-18-7-6-14(12,17)11-4-3-5-13(16)8-11/h3-5,8,12,16-17H,6-7,9-10H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | ANQLYNHHEHTLNJ-TZMCWYRMSA-N |
| XLogP | 1.18 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |