C24H34N2O2 — CID 141444117
3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)-1-(1-phenylbutyl)piperidin-4-ol (PubChem CID 141444117) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)-1-(1-phenylbutyl)piperidin-4-ol.
| Compound Name | 3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)-1-(1-phenylbutyl)piperidin-4-ol |
|---|---|
| PubChem CID | 141444117 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 3-[(dimethylamino)methyl]-4-(3-hydroxyphenyl)-1-(1-phenylbutyl)piperidin-4-ol |
| SMILES | CCCC(c1ccccc1)N1CCC(O)(c2cccc(O)c2)C(CN(C)C)C1 |
| InChI | InChI=1S/C24H34N2O2/c1-4-9-23(19-10-6-5-7-11-19)26-15-14-24(28,21(18-26)17-25(2)3)20-12-8-13-22(27)16-20/h5-8,10-13,16,21,23,27-28H,4,9,14-15,17-18H2,1-3H3 |
| InChIKey | SRSWGACVOIPIFB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |