C21H27NO3 — CID 15050161
(3S,4R)-3-[(dimethylamino)methyl]-4-(3-phenylmethoxyphenyl)oxan-4-ol (PubChem CID 15050161) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3S,4R)-3-[(dimethylamino)methyl]-4-(3-phenylmethoxyphenyl)oxan-4-ol.
| Compound Name | (3S,4R)-3-[(dimethylamino)methyl]-4-(3-phenylmethoxyphenyl)oxan-4-ol |
|---|---|
| PubChem CID | 15050161 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (3S,4R)-3-[(dimethylamino)methyl]-4-(3-phenylmethoxyphenyl)oxan-4-ol |
| SMILES | CN(C)C[C@H]1COCC[C@]1(O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H27NO3/c1-22(2)14-19-16-24-12-11-21(19,23)18-9-6-10-20(13-18)25-15-17-7-4-3-5-8-17/h3-10,13,19,23H,11-12,14-16H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | FVZBLSBNJROGKL-FPOVZHCZSA-N |
| XLogP | 3.05 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |