C23H28F3NO2 — CID 18935039
2-[(dimethylamino)methyl]-1-(3-phenylmethoxyphenyl)-5-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 18935039) has the molecular formula C23H28F3NO2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-(3-phenylmethoxyphenyl)-5-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 2-[(dimethylamino)methyl]-1-(3-phenylmethoxyphenyl)-5-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 18935039 |
| Molecular Formula | C23H28F3NO2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-(3-phenylmethoxyphenyl)-5-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CN(C)CC1CCC(C(F)(F)F)CC1(O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H28F3NO2/c1-27(2)15-20-12-11-19(23(24,25)26)14-22(20,28)18-9-6-10-21(13-18)29-16-17-7-4-3-5-8-17/h3-10,13,19-20,28H,11-12,14-16H2,1-2H3 |
| InChIKey | DHCUVMLCOGVFJY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |