C29H31F3N2O3 — CID 177307664
1-[3-[(dimethylamino)methyl]-4-hydroxy-4-(3-phenylmethoxyphenyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)ethanone (PubChem CID 177307664) has the molecular formula C29H31F3N2O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-4-hydroxy-4-(3-phenylmethoxyphenyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-[3-[(dimethylamino)methyl]-4-hydroxy-4-(3-phenylmethoxyphenyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 177307664 |
| Molecular Formula | C29H31F3N2O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-4-hydroxy-4-(3-phenylmethoxyphenyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)ethanone |
| SMILES | CN(C)CC1CN(C(=O)Cc2cc(F)c(F)cc2F)CCC1(O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H31F3N2O3/c1-33(2)17-23-18-34(28(35)14-21-13-26(31)27(32)16-25(21)30)12-11-29(23,36)22-9-6-10-24(15-22)37-19-20-7-4-3-5-8-20/h3-10,13,15-16,23,36H,11-12,14,17-19H2,1-2H3 |
| InChIKey | NZUHPMYBZFHZCJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|