C43H40F3N2O5+ — CID 171797954
[(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium (PubChem CID 171797954) has the molecular formula C43H40F3N2O5+ and a molecular weight of 724.81 g/mol. Its IUPAC name is [(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium.
| Compound Name | [(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium |
|---|---|
| PubChem CID | 171797954 |
| Molecular Formula | C43H40F3N2O5+ |
| Molecular Weight | 724.81 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | [(3S,4S)-4-benzoyloxy-4-(3-benzoyloxyphenyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]piperidin-3-yl]methyl-benzyl-methyl-(trideuteriomethyl)azanium |
| SMILES | [2H]C([2H])([2H])[N+](C)(Cc1ccccc1)C[C@@H]1CN(C(=O)Cc2cc(F)c(F)cc2F)CC[C@@]1(OC(=O)c1ccccc1)c1cccc(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C43H40F3N2O5/c1-48(2,28-30-13-6-3-7-14-30)29-35-27-47(40(49)24-33-23-38(45)39(46)26-37(33)44)22-21-43(35,53-42(51)32-17-10-5-11-18-32)34-19-12-20-36(25-34)52-41(50)31-15-8-4-9-16-31/h3-20,23,25-26,35H,21-22,24,27-29H2,1-2H3/q+1/t35-,43+/m0/s1/i1D3/t35-,43+,48? |
| InChIKey | IHCZQNZVJBTXLS-MMKXIXQXSA-N |
| XLogP | 7.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.81 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|