C23H30N2O3 — CID 156703364
[4-amino-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] benzoate (PubChem CID 156703364) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is [4-amino-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] benzoate.
| Compound Name | [4-amino-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 156703364 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | [4-amino-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] benzoate |
| SMILES | COc1cccc(C2(OC(=O)c3ccccc3)CCC(N)CC2CN(C)C)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-25(2)16-19-14-20(24)12-13-23(19,18-10-7-11-21(15-18)27-3)28-22(26)17-8-5-4-6-9-17/h4-11,15,19-20H,12-14,16,24H2,1-3H3 |
| InChIKey | IBJOSWKWCACJIA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |