C17H25NO3 — CID 3056585
[2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] formate (PubChem CID 3056585) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] formate.
| Compound Name | [2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] formate |
|---|---|
| PubChem CID | 3056585 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] formate |
| SMILES | COc1cccc(C2(OC=O)CCCCC2CN(C)C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-18(2)12-15-7-4-5-10-17(15,21-13-19)14-8-6-9-16(11-14)20-3/h6,8-9,11,13,15H,4-5,7,10,12H2,1-3H3 |
| InChIKey | LWUJVFJGULDRKI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|