C23H29NO5 — CID 10294357
[3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxy-4-methoxybenzoate (PubChem CID 10294357) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxy-4-methoxybenzoate.
| Compound Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 10294357 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxy-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc([C@@]3(O)CCCC[C@@H]3CN(C)C)c2)c(O)c1 |
| InChI | InChI=1S/C23H29NO5/c1-24(2)15-17-7-4-5-12-23(17,27)16-8-6-9-19(13-16)29-22(26)20-11-10-18(28-3)14-21(20)25/h6,8-11,13-14,17,25,27H,4-5,7,12,15H2,1-3H3/t17-,23+/m1/s1 |
| InChIKey | KEFKGLNCOBLMNK-HXOBKFHXSA-N |
| XLogP | 3.56 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|