C26H40N2O4 — CID 54588045
[3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-[1-(acetamidomethyl)cyclohexyl]acetate (PubChem CID 54588045) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-[1-(acetamidomethyl)cyclohexyl]acetate.
| Compound Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-[1-(acetamidomethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 54588045 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-[1-(acetamidomethyl)cyclohexyl]acetate |
| SMILES | CC(=O)NCC1(CC(=O)Oc2cccc([C@@]3(O)CCCC[C@@H]3CN(C)C)c2)CCCCC1 |
| InChI | InChI=1S/C26H40N2O4/c1-20(29)27-19-25(13-6-4-7-14-25)17-24(30)32-23-12-9-11-21(16-23)26(31)15-8-5-10-22(26)18-28(2)3/h9,11-12,16,22,31H,4-8,10,13-15,17-19H2,1-3H3,(H,27,29)/t22-,26+/m1/s1 |
| InChIKey | SBHBWEMEYVWBFR-GJZUVCINSA-N |
| XLogP | 4.01 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|