C23H29NO5 — CID 69135770
[3-[(dimethylamino)methyl]-4-hydroxy-4-(3-methoxyphenyl)cyclohexyl] 2-hydroxybenzoate (PubChem CID 69135770) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [3-[(dimethylamino)methyl]-4-hydroxy-4-(3-methoxyphenyl)cyclohexyl] 2-hydroxybenzoate.
| Compound Name | [3-[(dimethylamino)methyl]-4-hydroxy-4-(3-methoxyphenyl)cyclohexyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 69135770 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [3-[(dimethylamino)methyl]-4-hydroxy-4-(3-methoxyphenyl)cyclohexyl] 2-hydroxybenzoate |
| SMILES | COc1cccc(C2(O)CCC(OC(=O)c3ccccc3O)CC2CN(C)C)c1 |
| InChI | InChI=1S/C23H29NO5/c1-24(2)15-17-14-19(29-22(26)20-9-4-5-10-21(20)25)11-12-23(17,27)16-7-6-8-18(13-16)28-3/h4-10,13,17,19,25,27H,11-12,14-15H2,1-3H3 |
| InChIKey | BNGFLIXCICRIGH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |