C26H43NO3 — CID 68612471
[(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] decanoate (PubChem CID 68612471) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is [(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] decanoate.
| Compound Name | [(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] decanoate |
|---|---|
| PubChem CID | 68612471 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | [(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexyl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@]1(c2cccc(OC)c2)CCCC[C@@H]1CN(C)C |
| InChI | InChI=1S/C26H43NO3/c1-5-6-7-8-9-10-11-18-25(28)30-26(22-16-14-17-24(20-22)29-4)19-13-12-15-23(26)21-27(2)3/h14,16-17,20,23H,5-13,15,18-19,21H2,1-4H3/t23-,26+/m1/s1 |
| InChIKey | UOULHJUJRRGXJH-BVAGGSTKSA-N |
| XLogP | 6.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|